BIOPEP-UWM: Report
| ID | 10819 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 890.9803 | Monoisotopic mass | 890.4596 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lee C. H., Hamdan N., Nyakuma B. B., Wong S. L., Wong K. Y., Tan H., Jamaluddin H., Lee T. H. | |
| Title | |
| Purification, identification and molecular docking studies of antioxidant and anti-inflammatory peptides from Edible Bird's Nest. Food Chem., 454, 139797, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C39H62N12O12/c1-20(2)14-25(33(56)49-26(15-22-18-43-19-44-22)34(57)46-24(39(62)63)8-4-5-11-40)48-35(58)27(17-31(53)54)47-32(55)21(3)45-36(59)28-9-6-12-50(28)38(61)29-10-7-13-51(29)37(60)23(41)16-30(42)52/h18-21,23-29H,4-17,40-41H2,1-3H3,(H2,42,52)(H,43,44)(H,45,59)(H,46,57)(H,47,55)(H,48,58)(H,49,56)(H,53,54)(H,62,63)/t21-,23-,24-,25-,26-,27-,28-,29-/m0/s1 InChIKey=WIGMIERYZQWFCH-XOBYPWAZSA-N |
| Database reference: |