BIOPEP-UWM: Report
| ID | 10821 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory peptide | |||
| Number of residues | 10 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 1239.4571 | Monoisotopic mass | 1238.6678 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lee C. H., Hamdan N., Nyakuma B. B., Wong S. L., Wong K. Y., Tan H., Jamaluddin H., Lee T. H. | |
| Title | |
| Purification, identification and molecular docking studies of antioxidant and anti-inflammatory peptides from Edible Bird's Nest. Food Chem., 454, 139797, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C63H90N12O14/c1-35(2)27-43(65)54(79)68-47(29-38-15-8-7-9-16-38)56(81)70-49(31-40-32-66-44-18-11-10-17-42(40)44)58(83)73-51(34-77)62(87)75-26-14-20-52(75)60(85)72-50(33-76)59(84)74-53(37(5)6)61(86)71-48(30-39-21-23-41(78)24-22-39)57(82)69-46(28-36(3)4)55(80)67-45(63(88)89)19-12-13-25-64/h7-11,15-18,21-24,32,35-37,43,45-53,66,76-78H,12-14,19-20,25-31,33-34,64-65H2,1-6H3,(H,67,80)(H,68,79)(H,69,82)(H,70,81)(H,71,86)(H,72,85)(H,73,83)(H,74,84)(H,88,89)/t43-,45-,46-,47-,48-,49-,50-,51-,52-,53-/m0/s1 InChIKey=CZJLKUZRBALGTL-XJHNTGDTSA-N |
| Database reference: |