BIOPEP-UWM: Report
| ID | 10824 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory peptide | |||
| Number of residues | 11 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 1244.3101 | Monoisotopic mass | 1243.5927 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lee C. H., Hamdan N., Nyakuma B. B., Wong S. L., Wong K. Y., Tan H., Jamaluddin H., Lee T. H. | |
| Title | |
| Purification, identification and molecular docking studies of antioxidant and anti-inflammatory peptides from Edible Bird's Nest. Food Chem., 454, 139797, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C53H81N17O18/c1-25(2)15-33(68-50(85)37(19-42(75)76)63-40(73)21-54)46(81)62-27(5)44(79)67-35(17-28-8-10-30(71)11-9-28)48(83)69-34(16-26(3)4)47(82)70-38(20-43(77)78)51(86)65-31(12-13-39(55)72)45(80)60-23-41(74)64-36(18-29-22-58-24-61-29)49(84)66-32(52(87)88)7-6-14-59-53(56)57/h8-11,22,24-27,31-38,71H,6-7,12-21,23,54H2,1-5H3,(H2,55,72)(H,58,61)(H,60,80)(H,62,81)(H,63,73)(H,64,74)(H,65,86)(H,66,84)(H,67,79)(H,68,85)(H,69,83)(H,70,82)(H,75,76)(H,77,78)(H,87,88)(H4,56,57,59)/t27-,31-,32-,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey=HXTVAOPIWSSOQJ-WJQKJTMHSA-N |
| Database reference: |