BIOPEP-UWM: Report
| ID | 10825 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 886.9454 | Monoisotopic mass | 886.4171 | |
| IC50 : | 333.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Y., Chen S., Shi W., Liu S., Chen X., Pan N., Wang X., Su Y., Liu Z. | |
| Title | |
| Targeted affinity purification and mechanism of action of angiotensin-converting enzyme (ACE) inhibitory peptides from sea cucumber gonads. Mar. Drugs, 22, 90, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C40H58N10O13/c1-5-20(3)32(49-35(57)25(12-13-29(42)51)45-36(58)27(17-31(54)55)46-34(56)24(41)16-30(52)53)38(60)47-26(15-23-18-43-19-44-23)37(59)50-33(21(4)6-2)39(61)48-28(40(62)63)14-22-10-8-7-9-11-22/h7-11,18-21,24-28,32-33H,5-6,12-17,41H2,1-4H3,(H2,42,51)(H,43,44)(H,45,58)(H,46,56)(H,47,60)(H,48,61)(H,49,57)(H,50,59)(H,52,53)(H,54,55)(H,62,63)/t20-,21-,24-,25-,26-,27-,28-,32-,33-/m0/s1 InChIKey=SNIXOPXTVBOOFL-JZWICQEVSA-N |
| Database reference: |