BIOPEP-UWM: Report
| ID | 10827 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1157.2347 | Monoisotopic mass | 1156.5398 | |
| IC50 : | 583.60 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Y., Chen S., Shi W., Liu S., Chen X., Pan N., Wang X., Su Y., Liu Z. | |
| Title | |
| Targeted affinity purification and mechanism of action of angiotensin-converting enzyme (ACE) inhibitory peptides from sea cucumber gonads. Mar. Drugs, 22, 90, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C53H72N16O14/c1-27(70)44(55)51(81)69-40(21-30-25-58-26-62-30)49(79)68-41(22-43(73)74)50(80)67-39(20-29-24-61-34-12-5-3-10-32(29)34)48(78)66-38(19-28-23-60-33-11-4-2-9-31(28)33)47(77)63-35(13-6-7-17-54)45(75)64-36(15-16-42(71)72)46(76)65-37(52(82)83)14-8-18-59-53(56)57/h2-5,9-12,23-27,35-41,44,60-61,70H,6-8,13-22,54-55H2,1H3,(H,58,62)(H,63,77)(H,64,75)(H,65,76)(H,66,78)(H,67,80)(H,68,79)(H,69,81)(H,71,72)(H,73,74)(H,82,83)(H4,56,57,59)/t27-,35+,36+,37+,38+,39+,40+,41+,44+/m1/s1 InChIKey=JXCMLWBLFFOJKS-KLGSNUFBSA-N |
| Database reference: |