BIOPEP-UWM: Report
| ID | 10828 |
| Name | Hypotensive peptide |
| sequence |
| Function: | |||
| Peptide lowering blood pressure in rats | |||
| Number of residues | 7 |
Activity code | hyp |
| Activity : | hypotensive |
|||
| Chemical mass | 1056.1311 | Monoisotopic mass | 1055.4923 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Y., Chen S., Shi W., Liu S., Chen X., Pan N., Wang X., Su Y., Liu Z. | |
| Title | |
| Targeted affinity purification and mechanism of action of angiotensin-converting enzyme (ACE) inhibitory peptides from sea cucumber gonads. Mar. Drugs, 22, 90, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C49H65N15O12/c50-16-6-5-12-34(43(70)60-35(14-15-40(65)66)44(71)61-36(48(75)76)13-7-17-55-49(52)53)59-45(72)37(18-26-22-56-32-10-3-1-8-29(26)32)63-46(73)38(19-27-23-57-33-11-4-2-9-30(27)33)64-47(74)39(21-41(67)68)62-42(69)31(51)20-28-24-54-25-58-28/h1-4,8-11,22-25,31,34-39,56-57H,5-7,12-21,50-51H2,(H,54,58)(H,59,72)(H,60,70)(H,61,71)(H,62,69)(H,63,73)(H,64,74)(H,65,66)(H,67,68)(H,75,76)(H4,52,53,55)/t31-,34-,35-,36-,37-,38-,39-/m0/s1 InChIKey=ZTQKWQQUTSAHJR-QOOAZBNCSA-N |
| Database reference: |