BIOPEP-UWM: Report
| ID | 10829 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 920.9155 | Monoisotopic mass | 920.3539 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Y., Chen S., Shi W., Liu S., Chen X., Pan N., Wang X., Su Y., Liu Z. | |
| Title | |
| Targeted affinity purification and mechanism of action of angiotensin-converting enzyme (ACE) inhibitory peptides from sea cucumber gonads. Mar. Drugs, 22, 90, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C43H52N8O15/c1-22(44)37(59)47-32(20-35(55)56)41(63)51-33(21-36(57)58)42(64)50-29(17-23-5-3-2-4-6-23)39(61)49-31(19-25-9-13-27(53)14-10-25)40(62)48-30(18-24-7-11-26(52)12-8-24)38(60)46-28(43(65)66)15-16-34(45)54/h2-14,22,28-33,52-53H,15-21,44H2,1H3,(H2,45,54)(H,46,60)(H,47,59)(H,48,62)(H,49,61)(H,50,64)(H,51,63)(H,55,56)(H,57,58)(H,65,66)/t22-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey=VHCLLNDIPNLIQA-RWWMWHHFSA-N |
| Database reference: |