BIOPEP-UWM: Report
| ID | 10830 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 364.4382 | Monoisotopic mass | 364.2104 | |
| IC50 : | 0.63 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Z., He H., Liu J., Gu H., Fu C., Zeb A., Che T., Shen S. | |
| Title | |
| Preparation and vasodilation mechanism of angiotensin-I converting enzyme inhibitory peptide from Ulva prolifera protein. Marine Drugs, 22, 398, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C18H28N4O4/c1-12(21-17(24)14(20)9-5-6-10-19)16(23)22-15(18(25)26)11-13-7-3-2-4-8-13/h2-4,7-8,12,14-15H,5-6,9-11,19-20H2,1H3,(H,21,24)(H,22,23)(H,25,26)/t12-,14-,15-/m0/s1 InChIKey=YIBOAHAOAWACDK-QEJZJMRPSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M02-001 |
| Database reference: |
| ChEBI: ID 159691 ChemSpider: ID 17224312 Metabolomics Workbench: ID 83469 PubChem: CID 16064706 |