BIOPEP-UWM: Report
| ID | 10836 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Activity against Salmonella | |||
| Number of residues | 8 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1013.2116 | Monoisotopic mass | 1012.5148 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sedaghati M, Ezzatpanah H., Boojar M. M. A., Ebrahimi M. T., Kobarfard F. | |
| Title | |
| Isolation and identification of some antibacterial peptides in the plasmin-digest of beta-casein. LWT, 68, 217-225, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C47H72N12O11S/c1-71-24-19-34(55-42(64)33(17-18-39(60)61)54-41(63)32(13-5-7-20-48)53-40(62)31(50)26-30-27-51-28-52-30)45(67)58-22-9-16-38(58)44(66)57-36(25-29-11-3-2-4-12-29)46(68)59-23-10-15-37(59)43(65)56-35(47(69)70)14-6-8-21-49/h2-4,11-12,27-28,31-38H,5-10,13-26,48-50H2,1H3,(H,51,52)(H,53,62)(H,54,63)(H,55,64)(H,56,65)(H,57,66)(H,60,61)(H,69,70)/t31-,32-,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey=PBQBGPKBTHCYMQ-QSVFAHTRSA-N Antithrombotic peptide according to the DFBP database |
| Database reference: |
| DFBP: ID DFBPANTH0158 EROP-Moscow: ID E24849 MBPDB: peptide HKEMPFPK |