BIOPEP-UWM: Report
| ID | 10852 |
| Name | Immunomodulating peptide |
| sequence |
| Function: | |||
| Immunomodulating | |||
| Number of residues | 6 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 742.9012 | Monoisotopic mass | 742.4574 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jacquot A., Gauthier S., Drouin R., Boutin Y. | |
| Title | |
| Proliferative effects of synthetic peptides from β-lactoglobulin and α-lactalbumin on murine splenocytes. Int. Dairy J., 20, 514-521, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C34H62N8O10/c1-7-20(6)28(42-29(46)21(36)11-14-27(44)45)33(50)41-25(17-19(4)5)32(49)40-24(16-18(2)3)31(48)38-22(12-13-26(37)43)30(47)39-23(34(51)52)10-8-9-15-35/h18-25,28H,7-17,35-36H2,1-6H3,(H2,37,43)(H,38,48)(H,39,47)(H,40,49)(H,41,50)(H,42,46)(H,44,45)(H,51,52)/t20-,21-,22-,23-,24-,25-,28-/m0/s1 InChIKey=QNDNDCZKPIZMJC-QOTDWYQRSA-N |
| Database reference: |
| MBPDB: peptide EILLQK |