BIOPEP-UWM: Report
| ID | 10856 |
| Name | Immunomodulating peptide |
| sequence |
| Function: | |||
| Immunomodulating | |||
| Number of residues | 10 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 1149.4499 | Monoisotopic mass | 1148.6832 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jacquot A., Gauthier S., Drouin R., Boutin Y. | |
| Title | |
| Proliferative effects of synthetic peptides from β-lactoglobulin and α-lactalbumin on murine splenocytes. Int. Dairy J., 20, 514-521, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C52H92N16O11S/c1-10-30(6)41(49(76)63-36(51(78)79)16-13-20-58-52(55)56)67-47(74)38(25-33-26-57-27-59-33)65-45(72)35(18-22-80-9)62-48(75)40-17-14-21-68(40)50(77)39(24-29(4)5)66-43(70)32(8)60-44(71)34(15-11-12-19-53)61-46(73)37(23-28(2)3)64-42(69)31(7)54/h26-32,34-41H,10-25,53-54H2,1-9H3,(H,57,59)(H,60,71)(H,61,73)(H,62,75)(H,63,76)(H,64,69)(H,65,72)(H,66,70)(H,67,74)(H,78,79)(H4,55,56,58)/t30-,31-,32-,34-,35-,36-,37-,38-,39-,40-,41-/m0/s1 InChIKey=ZHCGGIWOFXKTSB-NOWCNDNASA-N |
| Database reference: |
| J-GLOBAL: ID 200907078821844141 MBPDB: peptide ALKALPMHIR Nikkaji: ID J2.275.708C PubChem: CID 44518986 |