BIOPEP-UWM: Report
| ID | 10858 |
| Name | Immunomodulating peptide |
| sequence |
| Function: | |||
| Immunomodulating | |||
| Number of residues | 7 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 901.0593 | Monoisotopic mass | 900.5376 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jacquot A., Gauthier S., Drouin R., Boutin Y. | |
| Title | |
| Proliferative effects of synthetic peptides from β-lactoglobulin and α-lactalbumin on murine splenocytes. Int. Dairy J., 20, 514-521, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C39H72N12O12/c1-21(2)18-27(49-34(58)25(13-14-30(52)53)46-32(56)23(42)10-9-17-45-39(43)44)35(59)47-24(11-5-7-15-40)33(57)51-29(20-31(54)55)37(61)50-28(19-22(3)4)36(60)48-26(38(62)63)12-6-8-16-41/h21-29H,5-20,40-42H2,1-4H3,(H,46,56)(H,47,59)(H,48,60)(H,49,58)(H,50,61)(H,51,57)(H,52,53)(H,54,55)(H,62,63)(H4,43,44,45)/t23-,24-,25-,26-,27-,28-,29-/m0/s1 InChIKey=BVARCXLMSIYNON-BMGWUDNWSA-N |
| Database reference: |
| MBPDB: Peptide RELKDLK |