BIOPEP-UWM: Report
ID | 10861 |
Name | Alanine carboxypeptidase inhibitor |
sequence |
Function: | |||
Inhibitor of Alanine carboxypeptidase (EC 3.4.17.6) (MEROPS ID: M9E.002) | |||
Number of residues | 3 |
Activity code | acar |
Activity : | alanine carboxypeptidase inhibitor |
|||
Chemical mass | 306.3560 | Monoisotopic mass | 306.1574 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Levy C. C., Goldman P. | |
Title | |
Bacterial peptidases. 3. An enzyme specific for N-acyl linkages to alanine. J. Biol. Chem., 244, 4467-4472, 1969 | |
Year | Source |
1969 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: C1=CC=C(C=C1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C16H22N2O4/c1-10(2)9-13(15(20)17-11(3)16(21)22)18-14(19)12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3,(H,17,20)(H,18,19)(H,21,22)/t11-,13-/m0/s1 InChIKey=UGXSTVCPQHICEK-AAEUAGOBSA-N <ph> - N-terminal benzoic acid (ID 224 in the BIOPEP-UWM repository of amino acids and modifications) |
Database reference: |
BRENDA: Ligand benzoyl-Leu-Ala CAS: Registry No 82364-19-0 ChemSpider: ID 13077249 EPA CompTox: ID DTXSID00516611 J-GLOBAL: ID 200907048159150260 Nikkaji: ID J2.389.744J PubChem: CID 13055263 SureChEMBL: ID SCHEMBL9829689 UniChem: ID 27028186 Wikidata: ID Q82378102 ZINC: ID ZINC000001605731 |