BIOPEP-UWM: Report
| ID | 10864 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 662.6501 | Monoisotopic mass | 662.2764 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Liu Y., Li W., Han W. | |
| Title | |
| Antioxidant activity of soybean peptides and Keap1 protein: A combined in vitro and in silico analysis. LWT, 212, 117019, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C27H38N10O10/c1-13(22(41)34-19(7-21(39)40)26(45)37-20(10-38)27(46)47)33-24(43)17(5-14-8-28-11-31-14)36-25(44)18(6-15-9-29-12-32-15)35-23(42)16-3-2-4-30-16/h8-9,11-13,16-20,30,38H,2-7,10H2,1H3,(H,28,31)(H,29,32)(H,33,43)(H,34,41)(H,35,42)(H,36,44)(H,37,45)(H,39,40)(H,46,47)/t13-,16-,17-,18-,19-,20-/m0/s1 InChIKey=MZWFQLYOJFVWLM-VWTPSIDOSA-N |
| Database reference: |