BIOPEP-UWM: Report
| ID | 10865 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 959.9597 | Monoisotopic mass | 959.4197 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Liu Y., Li W., Han W. | |
| Title | |
| Antioxidant activity of soybean peptides and Keap1 protein: A combined in vitro and in silico analysis. LWT, 212, 117019, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C39H57N15O14/c1-17(2)31(43)37(65)52-24(10-28(41)56)38(66)54-7-3-4-26(54)36(64)51-22(9-19-14-45-16-47-19)34(62)50-23(12-30(58)59)35(63)49-21(8-18-13-44-15-46-18)33(61)48-20(5-6-27(40)55)32(60)53-25(39(67)68)11-29(42)57/h13-17,20-26,31H,3-12,43H2,1-2H3,(H2,40,55)(H2,41,56)(H2,42,57)(H,44,46)(H,45,47)(H,48,61)(H,49,63)(H,50,62)(H,51,64)(H,52,65)(H,53,60)(H,58,59)(H,67,68)/t20-,21-,22-,23-,24-,25-,26-,31-/m0/s1 InChIKey=YDLZALUYYVGNOM-UAUDRASISA-N |
| Database reference: |