BIOPEP-UWM: Report
| ID | 10866 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 11 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1198.2402 | Monoisotopic mass | 1197.5720 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Liu Y., Li W., Han W. | |
| Title | |
| Antioxidant activity of soybean peptides and Keap1 protein: A combined in vitro and in silico analysis. LWT, 212, 117019, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C48H79N17O19/c1-22(2)37(52)44(80)62-27(18-34(51)70)45(81)64-16-4-7-30(64)42(78)60-25(11-14-36(72)73)40(76)63-28(20-66)41(77)59-24(10-13-33(50)69)39(75)58-23(9-12-32(49)68)38(74)56-19-35(71)57-29(21-67)46(82)65-17-5-8-31(65)43(79)61-26(47(83)84)6-3-15-55-48(53)54/h22-31,37,66-67H,3-21,52H2,1-2H3,(H2,49,68)(H2,50,69)(H2,51,70)(H,56,74)(H,57,71)(H,58,75)(H,59,77)(H,60,78)(H,61,79)(H,62,80)(H,63,76)(H,72,73)(H,83,84)(H4,53,54,55)/t23-,24-,25-,26-,27-,28-,29-,30-,31-,37-/m0/s1 InChIKey=UKUBJDSHDRBQQN-DIGNQEHISA-N |
| Database reference: |