BIOPEP-UWM: Report
| ID | 10867 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 445.5537 | Monoisotopic mass | 445.2681 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Z., Rivas-Serna I. M., Monirujjaman, Fernando I. P. S., Mazurak V. C., Wu J. | |
| Title | |
| Anti-inflammatory and antioxidative effects of bioactive peptides IKW and RIY in spontaneously hypertensive rats and angiotensin II-stimulated vascular smooth muscle cells. Food Biosci., 62, 105417, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C23H35N5O4/c1-3-14(2)20(25)22(30)27-18(10-6-7-11-24)21(29)28-19(23(31)32)12-15-13-26-17-9-5-4-8-16(15)17/h4-5,8-9,13-14,18-20,26H,3,6-7,10-12,24-25H2,1-2H3,(H,27,30)(H,28,29)(H,31,32)/t14-,18-,19-,20-/m0/s1 InChIKey=CEPIAEUVRKGPGP-DSYPUSFNSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTDB database; BIOPEP-UWM database of bioactive peptides; the BRENDA database; the DFBP database; the EROP-Moscow database Activator of Angiotensin 2-converting enzyme (ACE2) (EC 3.4.17.23) (MEROPS ID: M02.006) according to the BIOPEP-UWM database of bioactive peptides (ID 10682) |
| Database reference: |
| AHTPDB: ID 1598, 1652, 2021, 2599, 2855, 2859, 2894, 3767, 4202, 4975, 5061, 5718, 6532 BIOEP-UWM database of bioactive peptides: ID 7546; 10682 BRENDA: Ligand Ile-Lys-Trp ChEBI: ID 158604 ChemSpider: ID 8000528 DFBP: ID DFBPACEI0090; DFBPANHY0514; DFBPMUFU0042 EROP-Moscow: ID E09190 J-Global: ID 200907057574999709 Metabolomics Workbench: ID 82893 Nikkaji: ID J1.356.192C PubChem: CID 9824781 SATPdb: ID satpdb19180 |