BIOPEP-UWM: Report
| ID | 10872 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 976.1225 | Monoisotopic mass | 975.5049 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Guo H., Zang C., Zheng L., Ding L., Yang W., Ren S., Guan H. | |
| Title | |
| Novel antioxidant peptides from fermented whey protein by Lactobacillus rhamnosus B2-1: separation and identification by in vitro and in silico approaches. J. Agric. Food Chem., 72, 23306–23319, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C49H69N9O12/c1-29(2)41(46(66)53-35(21-22-40(60)61)47(67)57-25-9-15-38(57)44(64)55-37(49(69)70)28-30-11-4-3-5-12-30)56-45(65)39-16-10-26-58(39)48(68)36(27-31-17-19-32(59)20-18-31)54-43(63)34(13-6-7-23-50)52-42(62)33-14-8-24-51-33/h3-5,11-12,17-20,29,33-39,41,51,59H,6-10,13-16,21-28,50H2,1-2H3,(H,52,62)(H,53,66)(H,54,63)(H,55,64)(H,56,65)(H,60,61)(H,69,70)/t33-,34-,35-,36-,37-,38-,39-,41-/m0/s1 InChIKey=MFLLPIFEUHSHII-YEFFYANISA-N |
| Database reference: |