BIOPEP-UWM: Report
| ID | 10873 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1128.2332 | Monoisotopic mass | 1127.5383 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Guo H., Zang C., Zheng L., Ding L., Yang W., Ren S., Guan H. | |
| Title | |
| Novel antioxidant peptides from fermented whey protein by Lactobacillus rhamnosus B2-1: separation and identification by in vitro and in silico approaches. J. Agric. Food Chem., 72, 23306–23319, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O InChI=1S/C38H64N8O14/c1-8-20(6)30(38(59)60)45-36(57)29(19(4)5)44-34(55)24(12-14-28(50)51)42-35(56)26-10-9-15-46(26)37(58)25(17-47)43-31(52)21(7)40-33(54)23(11-13-27(48)49)41-32(53)22(39)16-18(2)3/h18-26,29-30,47H,8-17,39H2,1-7H3,(H,40,54)(H,41,53)(H,42,56)(H,43,52)(H,44,55)(H,45,57)(H,48,49)(H,50,51)(H,59,60)/t20-,21-,22-,23-,24-,25-,26-,29-,30-/m0/s1 InChIKey=QVRJIZLOUZSTHP-ZFKBFIRQSA-N |
| Database reference: |