BIOPEP-UWM: Report
| ID | 10884 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of pancreatic lipase (EC 3.4.23.1) | |||
| Number of residues | 3 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 309.3170 | Monoisotopic mass | 309.1320 | |
| IC50 : | 1183.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang X., Ai X., Zhu Z., Zhang M., Pan F., Yang Z., Wang O., Zhao L., Zhao L. | |
| Title | |
| Pancreatic lipase inhibitory effects of peptides derived from sesame proteins: In silico and in vitro analyses. Int. J. Biol. Macromol., 222, 1531-1537, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C14H19N3O5/c1-8(15)13(20)16-7-12(19)17-11(14(21)22)6-9-2-4-10(18)5-3-9/h2-5,8,11,18H,6-7,15H2,1H3,(H,16,20)(H,17,19)(H,21,22)/t8-,11-/m0/s1 InChIKey=NIZKGBJVCMRDKO-KWQFWETISA-N |
| Database reference: |
| ChEBI: ID 73351 ChemSpider: ID 28639270 Metabolomics Workbench: ID 79214 PubChem: CID 54113898 UniChem: ID 25470601 Wikidata: ID Q27140457 |