BIOPEP-UWM: Report
| ID | 10886 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 4 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 430.5618 | Monoisotopic mass | 430.2242 | |
| IC50 : | 5.01 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qi X., Chen H., Guan K., Sun Y., Wang R., Li Q., Ma Y. | |
| Title | |
| Novel xanthine oxidase inhibitory peptides derived from whey protein: identification, in vitro inhibition mechanism and in vivo activity validation. Bioorg. Chem., 128, 106097, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C19H34N4O5S/c1-11(2)10-14(22-16(24)12(3)20)18(26)23-8-5-6-15(23)17(25)21-13(19(27)28)7-9-29-4/h11-15H,5-10,20H2,1-4H3,(H,21,25)(H,22,24)(H,27,28)/t12-,13-,14-,15-/m0/s1 InChIKey=UYFLIGUEHGCLAI-AJNGGQMLSA-N |
| Database reference: |
| CAS: ID 769922-09-0 ChemSpider: ID 9851068 EPA CompTox: ID DTXSID90470455 PubChem: CID 11676339 UniChem: ID 34445416 Wikidata: ID Q82298552 |