BIOPEP-UWM: Report
| ID | 10888 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 480.5548 | Monoisotopic mass | 480.2365 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng Z., Li M., Zhang Z., Chen C., Qu X., Wang Z., Zhang D., Zhang C., Wu B., Sang X. | |
| Title | |
| Identification and in silico characterization of the novel inhibitory peptides of angiotensin converting enzyme from donkey meat. Int. J. Pept. Res. Therapeut., 31, 16, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C26H32N4O5/c1-17(27)25(33)30-14-8-13-22(30)24(32)28-20(15-18-9-4-2-5-10-18)23(31)29-21(26(34)35)16-19-11-6-3-7-12-19/h2-7,9-12,17,20-22H,8,13-16,27H2,1H3,(H,28,32)(H,29,31)(H,34,35)/t17-,20-,21-,22-/m0/s1 InChIKey=TYNQODPCJILSTC-MQGJPIDWSA-N |
| Database reference: |