BIOPEP-UWM: Report
| ID | 10889 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 829.9388 | Monoisotopic mass | 829.4110 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng Z., Li M., Zhang Z., Chen C., Qu X., Wang Z., Zhang D., Zhang C., Wu B., Sang X. | |
| Title | |
| Identification and in silico characterization of the novel inhibitory peptides of angiotensin converting enzyme from donkey meat. Int. J. Pept. Res. Therapeut., 31, 16, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C42H55N9O9/c1-24(2)36(43)40(57)46-23-35(53)50-17-9-15-32(50)38(55)47-25(3)41(58)51-18-10-16-33(51)39(56)49-30(20-27-21-44-29-14-8-7-13-28(27)29)37(54)45-22-34(52)48-31(42(59)60)19-26-11-5-4-6-12-26/h4-8,11-14,21,24-25,30-33,36,44H,9-10,15-20,22-23,43H2,1-3H3,(H,45,54)(H,46,57)(H,47,55)(H,48,52)(H,49,56)(H,59,60)/t25-,30-,31-,32-,33-,36-/m0/s1 InChIKey=UWQXKJBDXNWIRH-WITQEOTBSA-N |
| Database reference: |