BIOPEP-UWM: Report
| ID | 10890 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 778.8921 | Monoisotopic mass | 778.4001 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng Z., Li M., Zhang Z., Chen C., Qu X., Wang Z., Zhang D., Zhang C., Wu B., Sang X. | |
| Title | |
| Identification and in silico characterization of the novel inhibitory peptides of angiotensin converting enzyme from donkey meat. Int. J. Pept. Res. Therapeut., 31, 16, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C39H54N8O9/c1-5-23(2)33(46-35(51)25(4)43-34(50)24(3)40)37(53)45-28(19-26-13-8-6-9-14-26)38(54)47-18-12-17-30(47)36(52)42-21-31(48)41-22-32(49)44-29(39(55)56)20-27-15-10-7-11-16-27/h6-11,13-16,23-25,28-30,33H,5,12,17-22,40H2,1-4H3,(H,41,48)(H,42,52)(H,43,50)(H,44,49)(H,45,53)(H,46,51)(H,55,56)/t23-,24-,25-,28-,29-,30-,33-/m0/s1 InChIKey=SEAIWIVDZTYAGT-YLDWQYRQSA-N |
| Database reference: |