BIOPEP-UWM: Report
| ID | 10896 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 837.9591 | Monoisotopic mass | 837.4371 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fernandez Cunha M., Coscueta E. R., Brassesco M. E., Almada F., Gonçalves D., Pintado M. M. | |
| Title | |
| Bioprospecting bioactive peptides in Halobatrachus didactylus body mucus: from in silico insights to essential in vitro validation. Mar. Drugs, 23, 82, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C41H59N9O10/c1-24(2)20-27(39(57)50-19-9-15-32(50)38(56)47-29(41(59)60)22-33(42)51)46-37(55)31-14-7-17-48(31)34(52)23-44-36(54)30-13-8-18-49(30)40(58)28(21-25-10-4-3-5-11-25)45-35(53)26-12-6-16-43-26/h3-5,10-11,24,26-32,43H,6-9,12-23H2,1-2H3,(H2,42,51)(H,44,54)(H,45,53)(H,46,55)(H,47,56)(H,59,60)/t26-,27-,28-,29-,30-,31-,32-/m0/s1 InChIKey=NNCXOCIURQAUJP-YYGRSCHNSA-N |
| Database reference: |