BIOPEP-UWM: Report
| ID | 10899 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 328.3665 | Monoisotopic mass | 328.1854 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li J., Wei Y., Lei Y., Guo X., Zhao Y., Hao Q., Deng X., Zhang J. | |
| Title | |
| Screening, identification, and mechanistic exploration of DPP-IV inhibitory peptides from collagen in Esox lucius skin. Food Biosci., 63, 105698, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C13H24N6O4/c14-13(15)17-6-2-4-9(12(22)23)19-10(20)7-18-11(21)8-3-1-5-16-8/h8-9,16H,1-7H2,(H,18,21)(H,19,20)(H,22,23)(H4,14,15,17)/t8-,9-/m0/s1 InChIKey=DMKWYMWNEKIPFC-IUCAKERBSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the DFBP database, the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 2715, 4575, 4857, 5489, 6122 ChEBI: ID 162299 DFBP: ID DFBPACEI1252 EROP-Moscow: ID E25889 Metabolomics Workbench: ID 84797 PubChem: CID 145457469 SATPdb: ID satpdb13562 UniChem:ID 176705980 Wikidata: ID Q106028030 |