BIOPEP-UWM: Report
| ID | 10900 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 492.5275 | Monoisotopic mass | 492.2438 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li J., Wei Y., Lei Y., Guo X., Zhao Y., Hao Q., Deng X., Zhang J. | |
| Title | |
| Screening, identification, and mechanistic exploration of DPP-IV inhibitory peptides from collagen in Esox lucius skin. Food Biosci., 63, 105698, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C21H3N8O6/c22-13(7-4-8-26-21(24)25)18(32)27-11-17(31)28-14(9-12-5-2-1-3-6-12)19(33)29-15(20(34)35)10-16(23)30/h13-15H/t13-,14-,15-/m0/s1 InChIKey=ICKJNQYMVGDMNP-KKUMJFAQSA-N |
| Database reference: |