BIOPEP-UWM: Report
| ID | 10906 |
| Name | Neprilysin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Neprilysin (EC 3.4.24.11) (MEROPS ID: M13.001) | |||
| Number of residues | 2 |
Activity code | nep |
| Activity : | neprilysin inhibitor |
|||
| Chemical mass | 217.2647 | Monoisotopic mass | 217.1422 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Moreno-Mariscal C., Carrera-Alvarado G., Mora L., Toldrá F. | |
| Title | |
| Neprilysin (NEP) and Angiotensin Converting Enzyme-I (ACE-I) inhibitory dipeptides from chicken carcass hydrolysates. LWT, 221, 117591, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C9H19N3O3/c1-6(11)8(13)12-7(9(14)15)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,13)(H,14,15)/t6-,7-/m0/s1 InChIKey=QXRNAOYBCYVZCD-BQBZGAKWSA-N |
| Database reference: |
| BindingDB: ID 50169125 CAS: Registry No 6366-77-4 ChEBI: ID 132403 ChEMBL: ID CHEMBL191057 ChemSpider: ID 5379128 EPA CompTox: ID DTXSID30426799 FooDB: ID FDB111751 HMDB: ID HMDB0028692 J-GLOBAL: ID 200907030025108155 Metabolomics Workbench: ID 78667 Nikkaji: ID J81.207B PubChem: CID 7016106 UniChem: ID 173585 Wikidata: ID Q82239611 |