BIOPEP-UWM: Report
| ID | 10907 |
| Name | Neprilysin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Neprilysin (EC 3.4.24.11) (MEROPS ID: M13.001) | |||
| Number of residues | 2 |
Activity code | nep |
| Activity : | neprilysin inhibitor |
|||
| Chemical mass | 245.2781 | Monoisotopic mass | 245.1484 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Moreno-Mariscal C., Carrera-Alvarado G., Mora L., Toldrá F. | |
| Title | |
| Neprilysin (NEP) and Angiotensin Converting Enzyme-I (ACE-I) inhibitory dipeptides from chicken carcass hydrolysates. LWT, 221, 117591, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C9H19N5O3/c1-5(10)7(15)14-6(8(16)17)3-2-4-13-9(11)12/h5-6H,2-4,10H2,1H3,(H,14,15)(H,16,17)(H4,11,12,13)/t5-,6-/m0/s1 InChIKey=SITWEMZOJNKJCH-WDSKDSINSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (ID 7742), the DFBP database, the EROP-Moscow database Salty taste enhancing peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 421) |
| Database reference: |
| AHTPDB: ID 1699, 3274, 3891, 4704, 5136, 5870, 6110, 6690 BioPepDB: ID 7742 BIOPEP-UWM database of biactive peptides: ID 7742 BIOPEP-UWM database of sensory peptides and amino acids: ID 421 BRENDA: Ligand Ala-Arg CAS: Registry No 16709-12-9 ChEBI: ID 137238 ChemSpider: ID 393568 DFBP: ID DFBPACEI0224 EPA CompTox: ID DTXSID60332213 EROP-Moscow: ID E14726 FooDB: ID FDB111741 HMDB: ID HMDB0028681 J-GLOBAL: ID 200907044095231737 Metabolomics Workbench: ID 78657 MMDB: ID 1253.4 Nikkaji: ID J82.535B PubChem: CID 446132 SATPdb: ID satpdb15773 SureChEMBL: ID SCHEMBL2490761 UniChem: ID 25075270 Wikidata: ID Q82096759 ZINC: ID ZINC02579085 |