BIOPEP-UWM: Report
| ID | 10909 |
| Name | Neprilysin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Neprilysin (EC 3.4.24.11) (MEROPS ID: M13.001) | |||
| Number of residues | 2 |
Activity code | nep |
| Activity : | neprilysin inhibitor |
|||
| Chemical mass | 303.3141 | Monoisotopic mass | 303.1538 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Moreno-Mariscal C., Carrera-Alvarado G., Mora L., Toldrá F. | |
| Title | |
| Neprilysin (NEP) and Angiotensin Converting Enzyme-I (ACE-I) inhibitory dipeptides from chicken carcass hydrolysates. LWT, 221, 117591, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI= 1S/C11H21N5O5/c12-6(3-4-8(17)18)9(19)16-7(10(20)21)2-1-5-15-11(13)14/h6-7H,1-5,12H2,(H,16,19)(H,17,18)(H,20,21)(H4,13,14,15)/t6-,7-/m0/s1 InChIKey=MPZWMIIOPAPAKE-BQBZGAKWSA-N Inhibitor of angiotensin I-converting enzyme (EC 3.4.15.1; MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (ID 9944), the DFBP database, the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 2708, 4719, 5144, 6115 BioPepDB: ID biopep00188 BIOPEP-UWM database of bioactive peptides: ID 9944 CAS: Registry No 7219-59-2 ChemSpider: ID 7972216 ChEBI: ID 157844 DFBP: ID DFBPACEI1244, DFBPANHY0078, DFBPMUFU0274 EPA CompTox: ID DTXSID701313893 EROP-Moscow: ID E09356 FooDB: ID FDB111858 HMDB: ID HMDB0028813 Metabolomics Workbench: ID 78777 PubChem: CID 9796450 SATPdb: ID satpdb22163 SureChEMBL: ID SCHEMBL1090558 |