BIOPEP-UWM: Report
| ID | 10910 |
| Name | Neprilysin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Neprilysin (EC 3.4.24.11) (MEROPS ID: M13.001) | |||
| Number of residues | 2 |
Activity code | nep |
| Activity : | neprilysin inhibitor |
|||
| Chemical mass | 190.1536 | Monoisotopic mass | 190.0587 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Moreno-Mariscal C., Carrera-Alvarado G., Mora L., Toldrá F. | |
| Title | |
| Neprilysin (NEP) and Angiotensin Converting Enzyme-I (ACE-I) inhibitory dipeptides from chicken carcass hydrolysates. LWT, 221, 117591, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C6H10N2O5/c7-2-4(9)8-3(6(12)13)1-5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m0/s1 InChIKey=SCCPDJAQCXWPTF-VKHMYHEASA-N Inhibitor of angiotensin I-converting enzyme (EC 3.4.15.1; MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (ID 7620), the ChEMBL database, the DFBP database, the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1476, 1693, 3059, 3092, 3096, 3252, 3823, 3915, 4400, 4529, 4657, 6607 BindingDB: ID 50188493 BIOPEP-UWM database of bioactive peptides: ID 7620 CAS: Registry No 4685-12-5 ChEBI: ID 73804 ChEMBL: ID CHEMBL91392 ChemSpider: ID 87881 DFBP: ID DFBPACEI1629 ECHA: 225-140-1 EROP-Moscow: ID E10390 FooDB: ID FDB111876 HMDB: ID HMDB0028837 J-GLOBAL: ID 200907049288254043 Metabolomics Workbench: ID 78799 Nikkaji: ID J149.619K PlantPepDB: ID PPepDB_51 PubChem: CID 97363 SATPdb: ID satpdb27666 SureChEMBL: ID SCHEMBL3207709 UniChem: ID 546586 Wikidata: ID Q27144120 ZINC: ID ZINC000001708196 |