BIOPEP-UWM: Report
| ID | 10922 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 402.5306 | Monoisotopic mass | 402.2946 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Moreno-Mariscal C., Carrera-Alvarado G., Mora L., Toldrá F. | |
| Title | |
| Neprilysin (NEP) and Angiotensin Converting Enzyme-I (ACE-I) inhibitory dipeptides from chicken carcass hydrolysates. LWT, 221, 117591, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C18H38N6O4/c19-10-4-1-7-13(22)16(25)23-14(8-2-5-11-20)17(26)24-15(18(27)28)9-3-6-12-21/h13-15H,1-12,19-22H2,(H,23,25)(H,24,26)(H,27,28)/t13-,14-,15-/m0/s1 InChIKey=WBSCNDJQPKSPII-KKUMJFAQSA-N Bacterial permease ligand according to the BIOPEP-UWM database (ID 3752) |
| Database reference: |
| ACToR: ID 25988-63-0 BIOPEP-UWM database of bioactive peptides: ID 3752 BRENDA: Ligand Lys-Lys-Lys CAS: Registry No 25988-63-0 ChEBI: ID CHEBI:160118 ChEMBL: ID CHEMBL1229077 ChemSpider: ID 65300 EPA CompTox: ID DTXSID40948891 J-GLOBAL: ID 200907062475057037 Metabolomics Workbench: ID 83687 Nikkaji: ID J535.915E PubChem: CID 72363 UNII: ID Y7F82M80K8 SureChEMBL: ID SCHEMBL3796535 UniChem: ID 638812 Wikidata: ID Q27294355 ZINC: ID ZINC000004556777 |