BIOPEP-UWM: Report
ID | 10944 |
Name | Hyaluronidase inhibitor |
sequence |
Function: | |||
Inhibitor of Hyaluronidase (EC 3.2.1.35) | |||
Number of residues | 7 |
Activity code | hyal |
Activity : | Hyaluronidase inhibitor |
|||
Chemical mass | 569.6097 | Monoisotopic mass | 569.2913 | |
IC50 : | 13640.00 µM |
Bibliographic data: | |
Authors | |
Xue W., Kuang X., Meng X., Sun B., Zhao Z., Liang G. | |
Title | |
Identification and inhibition mechanism of novel collagen-derived hyaluronidase inhibitory peptides. Food Biosci., 66, 106263, 2025 | |
Year | Source |
2025 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C23H39N9O8/c24-10-17(34)31-8-2-5-15(31)21(38)30-14(12-33)19(36)28-11-18(35)32-9-3-6-16(32)20(37)29-13(22(39)40)4-1-7-27-23(25)26/h13-16,33H,1-12,24H2,(H,28,36)(H,29,37)(H,30,38)(H,39,40)(H4,25,26,27)/t13-,14-,15-,16-/m0/s1 InChIKey=HKXCZMSAQSJLTQ-VGWMRTNUSA-N |
Database reference: |