BIOPEP-UWM: Report
| ID | 10945 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1114.2554 | Monoisotopic mass | 1113.4680 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lu X., Zhang L., Sun Q., Song G., Huang J. | |
| Title | |
| Extraction, identification and structure-activity relationship of antioxidant peptides from sesame (Sesamum indicum L.) protein hydrolysate, Food Res. Int., 116, 707–716, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C44H10N15O15S2/c1-21(61)33(58-39(70)31-7-4-16-59(31)41(72)28(55-34(65)24(45)18-60)17-22-8-10-23(62)11-9-22)40(71)53-26(12-13-32(63)64)36(67)57-29(19-75)37(68)52-25(5-2-14-50-43(46)47)35(66)56-30(20-76)38(69)54-27(42(73)74)6-3-15-51-44(48)49/h21,24-31,33H/t21-,24+,25+,26+,27+,28+,29+,30+,31+,33+/m1/s1 InChIKey=ZLWCXTKKCOOJLQ-IANSXDRVSA-N |
| Database reference: |