BIOPEP-UWM: Report
| ID | 10946 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1009.1209 | Monoisotopic mass | 1008.5562 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lu X., Zhang L., Sun Q., Song G., Huang J. | |
| Title | |
| Extraction, identification and structure-activity relationship of antioxidant peptides from sesame (Sesamum indicum L.) protein hydrolysate, Food Res. Int., 116, 707–716, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)O InChI=1S/C41H72N18O12/c1-3-21(2)32(39(71)52-19-31(63)64)59-36(68)24(9-4-5-13-42)54-35(67)26(11-12-29(44)60)56-37(69)27(16-22-18-49-20-53-22)58-34(66)25(10-7-15-51-41(47)48)55-38(70)28(17-30(61)62)57-33(65)23(43)8-6-14-50-40(45)46/h18,20-21,23-28,32H,3-17,19,42-43H2,1-2H3,(H2,44,60)(H,49,53)(H,52,71)(H,54,67)(H,55,70)(H,56,69)(H,57,65)(H,58,66)(H,59,68)(H,61,62)(H,63,64)(H4,45,46,50)(H4,47,48,51)/t21-,23-,24-,25-,26-,27-,28-,32-/m0/s1 InChIKey=QOFGDDZKROBVAV-ZVUDQHFMSA-N |
| Database reference: |