BIOPEP-UWM: Report
| ID | 10947 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1053.1733 | Monoisotopic mass | 1052.5823 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lu X., Zhang L., Sun Q., Song G., Huang J. | |
| Title | |
| Extraction, identification and structure-activity relationship of antioxidant peptides from sesame (Sesamum indicum L.) protein hydrolysate, Food Res. Int., 116, 707–716, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C43H76N18O13/c1-21(2)16-28(37(69)58-27(41(73)74)10-7-15-53-43(49)50)59-34(66)24(8-4-5-13-44)55-36(68)26(11-12-31(45)63)57-38(70)29(17-23-19-51-20-54-23)60-35(67)25(9-6-14-52-42(47)48)56-39(71)30(18-32(64)65)61-40(72)33(46)22(3)62/h19-22,24-30,33,62H,4-18,44,46H2,1-3H3,(H2,45,63)(H,51,54)(H,55,68)(H,56,71)(H,57,70)(H,58,69)(H,59,66)(H,60,67)(H,61,72)(H,64,65)(H,73,74)(H4,47,48,52)(H4,49,50,53)/t22-,24+,25+,26+,27+,28+,29+,30+,33+/m1/s1 InChIKey=OXFYVUQXRSKQLG-FENSBQOHSA-N |
| Database reference: |