BIOPEP-UWM: Report
| ID | 10948 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1062.1137 | Monoisotopic mass | 1061.4545 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lu X., Zhang L., Sun Q., Song G., Huang J. | |
| Title | |
| Extraction, identification and structure-activity relationship of antioxidant peptides from sesame (Sesamum indicum L.) protein hydrolysate, Food Res. Int., 116, 707–716, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C40H67N15O17S/c1-17(2)31(38(70)54-23(14-27(44)58)35(67)51-20(6-8-25(42)56)33(65)48-16-28(59)49-21(39(71)72)7-9-29(60)61)55-34(66)19(5-4-11-47-40(45)46)50-37(69)24(15-30(62)63)53-36(68)22(13-26(43)57)52-32(64)18(41)10-12-73-3/h17-24,31H,4-16,41H2,1-3H3,(H2,42,56)(H2,43,57)(H2,44,58)(H,48,65)(H,49,59)(H,50,69)(H,51,67)(H,52,64)(H,53,68)(H,54,70)(H,55,66)(H,60,61)(H,62,63)(H,71,72)(H4,45,46,47)/t18-,19-,20-,21-,22-,23-,24-,31-/m0/s1 InChIKey=ZAUYCFLAVGJWGJ-OEWCNXHOSA-N |
| Database reference: |