BIOPEP-UWM: Report
| ID | 10952 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 351.4865 | Monoisotopic mass | 351.1281 | |
| IC50 : | 882.30 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan J., Dang K., Wang Y., Du L., Pan D., Dang Y., Gao X. | |
| Title | |
| Evaluation of novel angiotensin I-converting enzyme and dipeptidyl peptidase IV inhibitory peptides derived from yak milk based on peptidomics and network pharmacology. Food Biosci., 67, 106030, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C13H3N3O4S2/c1-8(15-12(18)9(14)4-6-21-2)11(17)16-10(13(19)20)5-7-22-3/h8-10H/t8-,9-,10-/m0/s1 InChIKey=VTKPSXWRUGCOAC-GUBZILKMSA-N |
| Database reference: |
| BRENDA: Ligand Met-Ala-Met ChEBI: ID 140747 Metabolomics Workbench: ID 83868 PubChem: CID 129656953 UniChem: ID 161183191 Wikidata: ID Q106026309 |