BIOPEP-UWM: Report
ID | 10952 |
Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
sequence |
Function: | |||
Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
Number of residues | 3 |
Activity code | dpp |
Activity : | dipeptidyl peptidase IV inhibitor |
|||
Chemical mass | 351.4865 | Monoisotopic mass | 351.1281 | |
IC50 : | 882.30 µM |
Bibliographic data: | |
Authors | |
Lan J., Dang K., Wang Y., Du L., Pan D., Dang Y., Gao X. | |
Title | |
Evaluation of novel angiotensin I-converting enzyme and dipeptidyl peptidase IV inhibitory peptides derived from yak milk based on peptidomics and network pharmacology. Food Biosci., 67, 106030, 2025 | |
Year | Source |
2025 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C13H3N3O4S2/c1-8(15-12(18)9(14)4-6-21-2)11(17)16-10(13(19)20)5-7-22-3/h8-10H/t8-,9-,10-/m0/s1 InChIKey=VTKPSXWRUGCOAC-GUBZILKMSA-N |
Database reference: |
BRENDA: Ligand Met-Ala-Met ChEBI: ID 140747 Metabolomics Workbench: ID 83868 PubChem: CID 129656953 UniChem: ID 161183191 Wikidata: ID Q106026309 |