BIOPEP-UWM: Report
| ID | 10967 |
| Name | Alcohol dehydrogenase activator |
| sequence |
| Function: | |||
| Acvtivator of alcohol dehydrogenase (EC 1.1.1.1) | |||
| Number of residues | 5 |
Activity code | adha |
| Activity : | alcohol dehydrogenase activator |
|||
| Chemical mass | 679.6772 | Monoisotopic mass | 679.2916 | |
| EC50 : | 1470.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen Y., Zhang X., Zheng Z., Cao W., Qin X., Lin H., Chen Z., Zheng H., Zhu G., Gao J. | |
| Title | |
| In silico prospecting of ADH activating peptides from Pacific oyster (Crassostrea gigas) and protective effect on ethanol-induced damage in HepG2 cells. Food Chem., 479, 143777, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C28H5N9O11/c29-15(8-9-20(30)38)23(43)35-17(12-21(39)40)25(45)34-16(7-4-10-33-28(31)32)24(44)36-18(13-22(41)42)26(46)37-19(27(47)48)11-14-5-2-1-3-6-14/h15-19H/t15-,16-,17-,18-,19-/m0/s1 InChIKey=QUGPHNTUPXYRIP-VMXHOPILSA-N |
| Database reference: |