BIOPEP-UWM: Report
| ID | 10983 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 9 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1164.3098 | Monoisotopic mass | 1163.6069 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xu Y., Pei Y., Liu Z., Tan P., Liu R., Chu L., Zhang Y., Wang W., Wang H. | |
| Title | |
| Discovery of novel DPP4 inhibitory peptides from egg yolk by machine learning and molecular docking: In vitro and in vivo validation. Food Chem., 476, 143412, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C54H81N15O14/c1-5-28(2)44(69-50(79)36(13-8-9-23-55)64-49(78)39(20-22-43(72)73)65-48(77)38(19-21-42(57)71)63-46(75)30(4)62-45(74)29(3)56)52(81)66-37(14-10-24-60-54(58)59)47(76)67-40(25-31-15-17-33(70)18-16-31)51(80)68-41(53(82)83)26-32-27-61-35-12-7-6-11-34(32)35/h6-7,11-12,15-18,27-30,36-41,44,61,70H,5,8-10,13-14,19-26,55-56H2,1-4H3,(H2,57,71)(H,62,74)(H,63,75)(H,64,78)(H,65,77)(H,66,81)(H,67,76)(H,68,80)(H,69,79)(H,72,73)(H,82,83)(H4,58,59,60)/t28-,29-,30-,36-,37-,38-,39-,40-,41-,44-/m0/s1 InChIKey=HUKSXEHEMIRYIO-DGGJFMSGSA-N |
| Database reference: |