BIOPEP-UWM: Report
| ID | 10985 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 457.4753 | Monoisotopic mass | 457.1842 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xu Y., Pei Y., Liu Z., Tan P., Liu R., Chu L., Zhang Y., Wang W., Wang H. | |
| Title | |
| Discovery of novel DPP4 inhibitory peptides from egg yolk by machine learning and molecular docking: In vitro and in vivo validation. Food Chem., 476, 143412, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C23H27N3O7/c24-17(10-11-20(28)29)21(30)25-18(12-15-6-8-16(27)9-7-15)22(31)26-19(23(32)33)13-14-4-2-1-3-5-14/h1-9,17-19,27H,10-13,24H2,(H,25,30)(H,26,31)(H,28,29)(H,32,33)/t17-,18-,19-/m0/s1 InChIKey=PMSDOVISAARGAV-FHWLQOOXSA-N |
| Database reference: |
| ChEBI: ID 163356 Metabolomics Workbench: ID 81829 PubChem: CID 10276141 UniChem: ID 34292441 Wikidata: ID Q106028328 |