BIOPEP-UWM: Report
| ID | 10986 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 456.5334 | Monoisotopic mass | 456.2365 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xu Y., Pei Y., Liu Z., Tan P., Liu R., Chu L., Zhang Y., Wang W., Wang H. | |
| Title | |
| Discovery of novel DPP4 inhibitory peptides from egg yolk by machine learning and molecular docking: In vitro and in vivo validation. Food Chem., 476, 143412, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C24H32N4O5/c25-13-5-4-8-20(27-22(30)19(26)14-17-9-11-18(29)12-10-17)23(31)28-21(24(32)33)15-16-6-2-1-3-7-16/h1-3,6-7,9-12,19-21,29H,4-5,8,13-15,25-26H2,(H,27,30)(H,28,31)(H,32,33)/t19-,20-,21-/m0/s1 InChIKey=CWVHKVVKAQIJKY-ACRUOGEOSA-N |
| Database reference: |
| ChEBI: ID 165164 Metabolomics Workbench: ID 86489 PubChem: CID 145458709 UniChem: ID 176707198 Wikidata: ID Q106024499 |