BIOPEP-UWM: Report
| ID | 10996 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 451.4757 | Monoisotopic mass | 451.2173 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu W.-Y., Zhang J.-T., Miyakawa T., Li G.-M., Gu R.-Z. Tanokura M. | |
| Title | |
| Antioxidant properties and inhibition of angiotensin‑converting enzyme by highly active peptides from wheat gluten. Sci. Rep., 11, 5206, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C19H29N7O6/c20-13(2-1-7-23-19(21)22)17(30)25-9-15(28)24-10-16(29)26-14(18(31)32)8-11-3-5-12(27)6-4-11/h3-6,13-14,27H,1-2,7-10,20H2,(H,24,28)(H,25,30)(H,26,29)(H,31,32)(H4,21,22,23)/t13-,14-/m0/s1 InChIKey=XMAZNIVIFRRLEX-KBPBESRZSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |