BIOPEP-UWM: Report
| ID | 10999 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 430.4582 | Monoisotopic mass | 430.2282 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu W.-Y., Zhang J.-T., Miyakawa T., Li G.-M., Gu R.-Z. Tanokura M. | |
| Title | |
| Antioxidant properties and inhibition of angiotensin‑converting enzyme by highly active peptides from wheat gluten. Sci. Rep., 11, 5206, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C16H30N8O6/c17-8(3-5-11(18)25)13(27)23-9(2-1-7-22-16(20)21)14(28)24-10(15(29)30)4-6-12(19)26/h8-10H,1-7,17H2,(H2,18,25)(H2,19,26)(H,23,27)(H,24,28)(H,29,30)(H4,20,21,22)/t8-,9-,10-/m0/s1 InChIKey=WOACHWLUOFZLGJ-GUBZILKMSA-N |
| Database reference: |
| ChEBI: ID 161910 Metabolomics Workbench: ID 81081 PubChem: CID 145454965 UniChem: ID 176703533 Wikidata: ID Q106016332 |