BIOPEP-UWM: Report
| ID | 11000 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 400.5148 | Monoisotopic mass | 400.2790 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu W.-Y., Zhang J.-T., Miyakawa T., Li G.-M., Gu R.-Z. Tanokura M. | |
| Title | |
| Antioxidant properties and inhibition of angiotensin‑converting enzyme by highly active peptides from wheat gluten. Sci. Rep., 11, 5206, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C18H36N6O4/c1-5-11(4)14(19)16(26)24-13(9-10(2)3)15(25)23-12(17(27)28)7-6-8-22-18(20)21/h10-14H,5-9,19H2,1-4H3,(H,23,25)(H,24,26)(H,27,28)(H4,20,21,22)/t11-,12-,13-,14-/m0/s1 InChIKey=PKGGWLOLRLOPGK-XUXIUFHCSA-N |
| Database reference: |
| ChEBI: ID 158532 Metabolomics Workbench: ID 82857 PubChem: CID 25217846 UniChem: ID 32103705 Wikidata: ID Q106026838 |