BIOPEP-UWM: Report
| ID | 11001 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 317.3802 | Monoisotopic mass | 317.1944 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu W.-Y., Zhang J.-T., Miyakawa T., Li G.-M., Gu R.-Z. Tanokura M. | |
| Title | |
| Antioxidant properties and inhibition of angiotensin‑converting enzyme by highly active peptides from wheat gluten. Sci. Rep., 11, 5206, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C14H27N3O5/c1-7(2)5-9(15)12(19)17-11(8(3)4)13(20)16-10(6-18)14(21)22/h7-11,18H,5-6,15H2,1-4H3,(H,16,20)(H,17,19)(H,21,22)/t9-,10-,11-/m0/s1 InChIKey=VKVDRTGWLVZJOM-DCAQKATOSA-N |
| Database reference: |
| BRENDA: Ligand Leu-Val-Ser ChEBI: ID 73578 Metabolights: ID MTBLC73578 Metabolomics Workbench: ID 83451 NMRShiftDB: ID 60023573 PubChem: CID 9858135 UniChem: ID 32025300 Wikidata: ID Q27141628 ZINC: ID ZINC000013508431 |