BIOPEP-UWM: Report
| ID | 11002 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 878.9680 | Monoisotopic mass | 878.4273 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lv X., Yuan S., Sun Y., Zhang Y., Yang W., Xu H., Yan W., Bai Q., Bai F., Cui F., Li J., Li X., Wang Z., Zhang G., Hou P. | |
| Title | |
| Isolation and identification of a novel antioxidant peptide from fermented sea cucumber (Stichopus japonicus) intestine and its protective effects on HepG2 cells from oxidative damage. J. Agric. Food Chem., 73, 9662–9676, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C42H58N10O11/c1-23(44)36(56)47-24(2)37(57)48-25(3)38(58)51-32(19-26-11-5-4-6-12-26)41(61)50-31(16-17-35(54)55)39(59)46-22-34(53)49-30(15-9-10-18-43)40(60)52-33(42(62)63)20-27-21-45-29-14-8-7-13-28(27)29/h4-8,11-14,21,23-25,30-33,45H,9-10,15-20,22,43-44H2,1-3H3,(H,46,59)(H,47,56)(H,48,57)(H,49,53)(H,50,61)(H,51,58)(H,52,60)(H,54,55)(H,62,63)/t23-,24-,25-,30-,31-,32-,33-/m0/s1 InChIKey=TXJIQWLTGUSCDK-UAPQJMQMSA-N |
| Database reference: |