BIOPEP-UWM: Report
| ID | 11003 |
| Name | Antidiabetic peptide |
| sequence |
| Function: | |||
| Antidiabetic | |||
| Number of residues | 5 |
Activity code | adb |
| Activity : | antidiabetic |
|||
| Chemical mass | 644.8032 | Monoisotopic mass | 644.3998 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Anwar I., Khan F. B., Baby B., Antony P., Mudgil P., Gan C.-Y., Maqsood S., Vijayan R., Muhammad K., Ayoub M. A. | |
| Title | |
| Functional profiling of synthetic camel milk derived peptides with implication in glucose transport and diabetes. PLoS ONE, 20, e0320812, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C32H52N8O6/c1-19(2)16-22(33)27(41)37-23(12-8-14-36-32(34)35)30(44)40-15-9-13-26(40)29(43)38-24(18-21-10-6-5-7-11-21)28(42)39-25(31(45)46)17-20(3)4/h5-7,10-11,19-20,22-26H,8-9,12-18,33H2,1-4H3,(H,37,41)(H,38,43)(H,39,42)(H,45,46)(H4,34,35,36)/t22-,23-,24-,25-,26-/m0/s1 InChIKey=KWSRBRGYGPODKU-LROMGURASA-N |
| Database reference: |