BIOPEP-UWM: Report
| ID | 11004 |
| Name | Antidiabetic peptide |
| sequence |
| Function: | |||
| Antidiabetic | |||
| Number of residues | 14 |
Activity code | adb |
| Activity : | antidiabetic |
|||
| Chemical mass | 1451.8425 | Monoisotopic mass | 1450.6571 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Anwar I., Khan F. B., Baby B., Antony P., Mudgil P., Gan C.-Y., Maqsood S., Vijayan R., Muhammad K., Ayoub M. A. | |
| Title | |
| Functional profiling of synthetic camel milk derived peptides with implication in glucose transport and diabetes. PLoS ONE, 20, e0320812, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CS)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C63H102N16O15S4/c1-32(2)24-41(71-55(85)44(29-96)74-56(86)43(28-95)73-50(80)35(7)68-59(89)49(34(5)6)76-51(81)36(8)67-52(82)38-14-10-19-65-38)61(91)79-22-13-17-48(79)62(92)78-21-12-16-47(78)57(87)72-42(25-33(3)4)60(90)77-20-11-15-46(77)58(88)75-45(30-97)54(84)70-40(26-37-27-64-31-66-37)53(83)69-39(63(93)94)18-23-98-9/h27,31-36,38-49,65,95-97H,10-26,28-30H2,1-9H3,(H,64,66)(H,67,82)(H,68,89)(H,69,83)(H,70,84)(H,71,85)(H,72,87)(H,73,80)(H,74,86)(H,75,88)(H,76,81)(H,93,94)/t35-,36-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48-,49-/m0/s1 InChIKey=KJMNTMUOQYLPTJ-ABPQYSPQSA-N |
| Database reference: |