BIOPEP-UWM: Report
| ID | 11006 |
| Name | Antidiabetic peptide |
| sequence |
| Function: | |||
| Antidiabetic | |||
| Number of residues | 4 |
Activity code | adb |
| Activity : | antidiabetic |
|||
| Chemical mass | 424.5329 | Monoisotopic mass | 424.2677 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Anwar I., Khan F. B., Baby B., Antony P., Mudgil P., Gan C.-Y., Maqsood S., Vijayan R., Muhammad K., Ayoub M. A. | |
| Title | |
| Functional profiling of synthetic camel milk derived peptides with implication in glucose transport and diabetes. PLoS ONE, 20, e0320812, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C21H36N4O5/c1-12(2)11-14(22)19(27)24-9-5-7-15(24)18(26)23-17(13(3)4)20(28)25-10-6-8-16(25)21(29)30/h12-17H,5-11,22H2,1-4H3,(H,23,26)(H,29,30)/t14-,15-,16-,17-/m0/s1 InChIKey=MMDBTZPMTOOVIR-QAETUUGQSA-N |
| Database reference: |
| ChemSpider: ID 9829500 PubChem: CID 11654762 |